CAS 39204-53-0

3-methylimidazo[1,5-a]pyrazine

Description:

3-Methylimidazo[1,5-a]pyrazine is a heterocyclic organic compound characterized by its fused ring structure, which includes both imidazole and pyrazine moieties. It is a derivative of imidazo[1,5-a]pyrazine, with a methyl group attached at the third position of the imidazole ring. This compound is typically colorless to pale yellow and is known for its aromatic properties. It is of interest in food chemistry due to its formation during the cooking of certain meats and its potential role as a mutagenic compound. The presence of nitrogen atoms in its structure contributes to its basicity and reactivity, making it a subject of study in toxicology and carcinogenicity research. Additionally, 3-methylimidazo[1,5-a]pyrazine is soluble in organic solvents, which can influence its behavior in biological systems. Its molecular structure and properties make it relevant in various fields, including pharmacology and environmental science, where understanding its effects and interactions is crucial.

Formula: C₇H₇N₃

InChI: InChI=1/C7H7N3/c1-6-9-5-7-4-8-2-3-10(6)7/h2-5H,1H3

SMILES: Cc1ncc2cnccn12

3-Methylimidazo[1,5-a]pyrazine

CAS: 39204-53-0

3-Methylimidazo[1,5-a]pyrazine

Purity: 98%

Molecular weight: 133.15g/mol

Ref: 54-OR1065500

3-Methylimidazo[1,5-a]pyrazine

Controlled Product

CAS: 39204-53-0

Formula: C₇H₇N₃

Color and Shape: Neat

Molecular weight: 133.15

Ref: TR-M313090