CAS 39206-70-7

2-(4-chlorophenyl)-4-oxo-4-phenylbutanoic acid

Description:

2-(4-Chlorophenyl)-4-oxo-4-phenylbutanoic acid, with the CAS number 39206-70-7, is an organic compound characterized by its distinctive structure, which includes a butanoic acid backbone substituted with a 4-chlorophenyl group and a phenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. It may display moderate to high lipophilicity due to the presence of aromatic rings, which can influence its behavior in biological systems and its interaction with other chemical entities. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may form salts or esters under appropriate conditions. Additionally, the chlorophenyl substituent may impart specific electronic effects, potentially affecting the compound's reactivity and stability. Overall, this compound may be of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features and potential applications.

Formula: C₁₆H₁₃ClO₃

InChI: InChI=1/C16H13ClO3/c17-13-8-6-11(7-9-13)14(16(19)20)10-15(18)12-4-2-1-3-5-12/h1-9,14H,10H2,(H,19,20)

SMILES: c1ccc(cc1)C(=O)CC(c1ccc(cc1)Cl)C(=O)O

2-(4-Chlorophenyl)-4-oxo-4-phenylbutanoic acid

CAS: 39206-70-7

Formula: C₁₆H₁₃ClO₃

Color and Shape: Solid

Molecular weight: 288.7256

Ref: IN-DA0075ZP

2-(4-Chlorophenyl)-4-oxo-4-phenylbutanoic acid

CAS: 39206-70-7

2-(4-Chlorophenyl)-4-oxo-4-phenylbutanoic acid

Purity: 95%

Molecular weight: 288.73g/mol

Ref: 54-OR15328

2-(4-Chlorophenyl)-4-oxo-4-phenylbutanoic acid

CAS: 39206-70-7

Purity: 95+%

Molecular weight: 288.730011

Ref: 10-F750889