CAS 39215-63-9

N-(2-methylprop-2-en-1-yl)hydrazinecarbothioamide

Description:

N-(2-methylprop-2-en-1-yl)hydrazinecarbothioamide, identified by its CAS number 39215-63-9, is a chemical compound that features a hydrazine functional group linked to a thioamide. This compound is characterized by its unique structure, which includes a branched alkene (2-methylprop-2-en-1-yl) moiety that contributes to its reactivity and potential applications in organic synthesis. The presence of the thioamide functional group imparts specific chemical properties, such as the ability to participate in nucleophilic reactions and form coordination complexes with metals. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Overall, N-(2-methylprop-2-en-1-yl)hydrazinecarbothioamide represents a versatile building block in the synthesis of more complex organic molecules.

Formula: C₅H₁₁N₃S

InChI: InChI=1/C5H11N3S/c1-4(2)3-7-5(9)8-6/h1,3,6H2,2H3,(H2,7,8,9)

3-Amino-1-(2-methylprop-2-en-1-yl)thiourea

CAS: 39215-63-9

Versatile small molecule scaffold

Formula: C₅H₁₁N₃S

Purity: Min. 95%

Molecular weight: 145.23 g/mol

Ref: 3D-PBA21563