CAS 3922-74-5
:Ethanamine, 2-(diphenylmethoxy)-N,N-dimethyl-, N-oxide
Description:
Ethanamine, 2-(diphenylmethoxy)-N,N-dimethyl-, N-oxide, with the CAS number 3922-74-5, is an organic compound characterized by its amine functional group and the presence of a diphenylmethoxy moiety. This compound typically exhibits properties associated with tertiary amines, including basicity and the ability to form salts with acids. The N-oxide designation indicates that it contains an oxygen atom bonded to the nitrogen atom, which can influence its reactivity and solubility in various solvents. The presence of the diphenylmethoxy group suggests that the compound may have significant steric hindrance, potentially affecting its interaction with other molecules. Additionally, compounds of this nature may be utilized in various applications, including as intermediates in organic synthesis or in the development of pharmaceuticals. Its specific physical properties, such as boiling point, melting point, and solubility, would depend on the molecular structure and the presence of functional groups, which can also influence its biological activity and environmental behavior.
Formula:C17H21NO2
InChI:InChI=1S/C17H21NO2/c1-18(2,19)13-14-20-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3
InChI key:InChIKey=OEQNVWKWQPTBSC-UHFFFAOYSA-N
SMILES:C(OCCN(C)(C)=O)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- Ethylamine, 2-(diphenylmethoxy)-N,N-dimethyl-, N-oxide
- Ethanamine, 2-(diphenylmethoxy)-N,N-dimethyl-, N-oxide
- NSC 9091
- (Dimethylamino)ethyl benzhydryl ether N-oxide
- Diphenhydramine N-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
Diphenhydramine N-Oxide
CAS:Formula:C17H21NO2Color and Shape:Pale Yellow SolidMolecular weight:271.36Diphenhydramine N-Oxide
CAS:Controlled ProductFormula:C17H21NO2Color and Shape:NeatMolecular weight:271.35Diphenhydramine N-Oxide
CAS:Stability Hygroscopic
Applications A metabolite of Diphenhydramine (D486900) in humans.
References Breyer-Pfaff, U., et al.: Drug Metab. Dispos., 25, 340 (1997),Formula:C17H21NO2Color and Shape:NeatMolecular weight:271.35Amoxydramine
CAS:Amoxydramine is a metabolite of Diphenhydramine in humans.Formula:C17H21NO2Color and Shape:SolidMolecular weight:271.35




