CymitQuimica logo

CAS 392244-44-9

:

4-chloro-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide

Description:
4-Chloro-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide is a chemical compound characterized by its unique structure, which includes a butanamide moiety linked to a 5-methyl-1,3,4-thiadiazole ring. The presence of a chlorine atom at the fourth position of the butanamide contributes to its reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound due to the inclusion of sulfur and nitrogen in its thiadiazole ring. It may exhibit properties such as antimicrobial or herbicidal activity, making it of interest in agricultural and pharmaceutical applications. The molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, its solubility and stability in different solvents can vary, influencing its practical applications. As with many synthetic compounds, safety data and handling precautions are essential, particularly due to the presence of chlorine, which can pose health risks if not managed properly.
Formula:C7H10ClN3OS
InChI:InChI=1/C7H10ClN3OS/c1-5-10-11-7(13-5)9-6(12)3-2-4-8/h2-4H2,1H3,(H,9,11,12)
SMILES:Cc1nnc(N=C(CCCCl)O)s1
Synonyms:
  • butanamide, 4-chloro-N-(5-methyl-1,3,4-thiadiazol-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.