CAS 39226-97-6

2-chloro-3-(trifluoromethyl)benzoic acid

Description:

2-Chloro-3-(trifluoromethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of a chloro group and a trifluoromethyl group on the benzene ring. The molecular structure features a benzoic acid moiety, which includes a carboxylic acid functional group (-COOH) attached to a benzene ring. The chloro substituent is located at the 2-position, while the trifluoromethyl group (-CF3) is positioned at the 3-position relative to the carboxylic acid. This compound is typically a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique electronic properties imparted by the electronegative fluorine atoms. The presence of both the chloro and trifluoromethyl groups can enhance the compound's lipophilicity and influence its reactivity, making it a subject of interest in synthetic organic chemistry. Additionally, its CAS number, 39226-97-6, is a unique identifier that facilitates its identification in chemical databases and regulatory frameworks.

Formula: C₈H₄ClF₃O₂

InChI: InChI=1/C8H4ClF3O2/c9-6-4(7(13)14)2-1-3-5(6)8(10,11)12/h1-3H,(H,13,14)

SMILES: c1cc(c(c(c1)C(F)(F)F)Cl)C(=O)O

Synonyms:

• 2-Chloro-3-Trifluoromethylbenzoic Acid

2-Chloro-3-(Trifluoromethyl)Benzoic Acid

CAS: 39226-97-6

Formula: C₈H₄ClF₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 224.5644

Ref: IN-DA00379L

2-Chloro-3-(trifluoromethyl)benzoic acid

CAS: 39226-97-6

2-Chloro-3-(trifluoromethyl)benzoic acid

Formula: C₈H₄ClF₃O₂

Purity: 98%

Color and Shape: white solid

Molecular weight: 224.56g/mol

Ref: 54-PC6734

2-Chloro-3-(trifluoromethyl)benzoic acid

CAS: 39226-97-6

Formula: C₈H₄ClF₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 224.56

Ref: 10-F007807

2-Chloro-3-(trifluoromethyl)benzoic Acid

Controlled Product

CAS: 39226-97-6

Formula: C₈H₄ClF₃O₂

Color and Shape: Neat

Molecular weight: 224.56

Ref: TR-C422265