CAS 39229-33-9
:2-(2-Chloroethoxy)acetyl chloride
Description:
2-(2-Chloroethoxy)acetyl chloride, with the CAS number 39229-33-9, is an organic compound characterized by its functional groups, including an acetyl chloride moiety and a chloroethoxy group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly as an acylating agent. It is soluble in organic solvents such as dichloromethane and ether but is generally insoluble in water due to its hydrophobic nature. The presence of the chloroethoxy group imparts certain electrophilic properties, making it useful in various synthetic applications, including the preparation of esters and other derivatives. As with many acyl chlorides, it can react vigorously with water, alcohols, and amines, releasing hydrochloric acid in the process. Safety precautions are essential when handling this compound, as it can be corrosive and irritating to the skin and respiratory system. Proper storage in a cool, dry place, away from moisture, is recommended to maintain its stability and reactivity.
Formula:C4H6Cl2O2
InChI:InChI=1S/C4H6Cl2O2/c5-1-2-8-3-4(6)7/h1-3H2
InChI key:InChIKey=RTSGMUHVJLAAAU-UHFFFAOYSA-N
SMILES:C(OCCCl)C(Cl)=O
Synonyms:- 2-(2-Chloroethoxy)acetyl chloride
- Acetyl Chloride, 2-(2-Chloroethoxy)-
- Acetyl chloride, (2-chloroethoxy)-
- (2-Chloroethoxy)acetyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(2-Chloroethoxy)acetyl Chloride
CAS:Controlled ProductApplications 2-(2-Chloroethoxy)acetyl Chloride (cas# 39229-33-9) is a compound useful in organic synthesis.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C4H6Cl2O2Color and Shape:NeatMolecular weight:157.00
