CAS 3923-52-2: 1,1-Diphenyl-2-propyn-1-ol
Description:1,1-Diphenyl-2-propyn-1-ol, with the CAS number 3923-52-2, is an organic compound characterized by its unique structure, which features a propyne moiety attached to a hydroxyl group and two phenyl groups. This compound is typically a colorless to pale yellow solid or liquid, depending on its purity and specific conditions. It exhibits properties typical of alcohols, including the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the alkyne functional group contributes to its reactivity, making it a potential candidate for further chemical transformations. Additionally, 1,1-Diphenyl-2-propyn-1-ol may exhibit interesting optical properties due to the presence of the phenyl rings, which can affect its behavior in UV-Vis spectroscopy. Its applications may span across organic synthesis, where it can serve as an intermediate or a reagent in various chemical reactions. As with many organic compounds, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C15H12O
InChI:InChI=1S/C15H12O/c1-2-15(16,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h1,3-12,16H
InChI key:InChIKey=SMCLTAARQYTXLW-UHFFFAOYSA-N
SMILES:C#CC(O)(C=1C=CC=CC1)C=2C=CC=CC2
- Synonyms:
- 1,1-Diphenyl-1-hydroxy-2-propyne
- 1,1-Diphenyl-2-propyne-1-ol
- 1,1-Diphenylprop-2-Yn-1-Ol
- 1,1-Diphenylpropargyl alcohol
- 1,1-Diphenylpropyn-1-ol
- 2-Propyn-1-ol, 1,1-diphenyl-
- 3,3-Diphenyl-3-hydroxy-1-propyne
- 3,3-Diphenyl-propyn-1-ol
- Benzenemethanol, α-ethynyl-α-phenyl-
- Diphenyl ethynyl carbinol
- See more synonyms
- Ethynyldiphenylmethanol
- NSC 113228
- α-Ethynyl-α-phenylbenzenemethanol
- 1,1-Diphenyl-2-propyn-1-ol
