CAS 392315-45-6

2-amino-6-ethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-ol

Description:

2-amino-6-ethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-ol is a heterocyclic compound characterized by its unique triazole and pyrimidine ring structures. This compound features an amino group at the 2-position, an ethyl group at the 6-position, and a methyl group at the 5-position of the triazole ring, contributing to its diverse chemical properties. The presence of the hydroxyl group at the 7-position enhances its potential for hydrogen bonding, which can influence its solubility and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure suggests potential interactions with biological targets, which could lead to various pharmacological effects. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the ring systems. Overall, 2-amino-6-ethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-ol represents a complex and potentially valuable chemical entity in medicinal chemistry.

Formula: C₈H₁₁N₅O

InChI: InChI=1/C8H11N5O/c1-3-5-4(2)10-8-11-7(9)12-13(8)6(5)14/h14H,3H2,1-2H3,(H2,9,12)

SMILES: CCc1c(C)nc2nc(=N)[nH]n2c1O

2-amino-6-ethyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-ol

CAS: 392315-45-6

Formula: C₈H₁₁N₅O

Purity: 95.0%

Molecular weight: 193.21

Ref: 10-F316068