CAS 39232-91-2
:(3-Methoxyphenyl)hydrazine hydrochloride
Description:
(3-Methoxyphenyl)hydrazine hydrochloride is a chemical compound characterized by its hydrazine functional group attached to a methoxy-substituted phenyl ring. It typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which makes it useful in different chemical applications. The presence of the methoxy group enhances its reactivity and solubility properties. This compound is often utilized in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals, due to its ability to participate in reactions such as hydrazone formation and other nucleophilic substitutions. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. As with many hydrazine derivatives, safety precautions should be observed when handling this compound, as hydrazines can be toxic and potentially hazardous. Proper storage conditions and handling protocols are essential to ensure safety and stability.
Formula:C7H11ClN2O
InChI:InChI=1/C7H10N2O.ClH/c1-10-7-4-2-3-6(5-7)9-8;/h2-5,9H,8H2,1H3;1H
InChI key:InChIKey=GMXFZBZOVZOYNQ-UHFFFAOYSA-N
SMILES:N(N)C1=CC(OC)=CC=C1.Cl
Synonyms:- (3-Methoxy-phenyl)-hydrazine HCl
- (3-Methoxyphenyl)Hydrazine
- (3-Methoxyphenyl)hydrazine hydrochloride
- (3-Methoxyphenyl)hydrazine monohydrochloride
- 3-Methoxyphenylhydrazine HCl
- Hydrazine, (3-methoxyphenyl)-, hydrochloride (1:1)
- Hydrazine, (3-methoxyphenyl)-, monohydrochloride
- Hydrazine, (m-methoxyphenyl)-, hydrochloride
- [3-(Methyloxy)phenyl]hydrazine monohydrochloride
- m-Methoxyphenylhydrazine hydrochloride
- 3-METHOXYPHENYLHYDRAZINE HYDROCHLORIDE
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(3-Methoxyphenyl)hydrazine hydrochloride
CAS:Formula:C7H10ClN2OPurity:95%Color and Shape:SolidMolecular weight:174.62803-Methoxyphenylhydrazine hydrochloride
CAS:3-Methoxyphenylhydrazine hydrochlorideFormula:C7H10N2O·ClHPurity:98%Color and Shape: brown solidMolecular weight:174.63g/mol3-Methoxyphenylhydrazine hydrochloride
CAS:Formula:C7H11ClN2OPurity:95%Color and Shape:SolidMolecular weight:174.63(3-Methoxyphenyl)hydrazine Hydrochloride
CAS:Controlled ProductApplications (3-Methoxyphenyl)hydrazine hydrochloride (cas# 39232-91-2) is a useful research chemical.
Formula:C7H10N2O·(HCl)Color and Shape:NeatMolecular weight:174.633-Methoxyphenylhydrazine HCl
CAS:3-Methoxyphenylhydrazine HCl is an ester form of 3-methoxyphenylhydrazine. It has been used as a reagent in analytical methods to introduce chiral centers into organic molecules and as a reagent for the determination of acetaldehyde in healthcare settings. It has also been used as an energy dispersive X-ray source for nanomaterials, which are particles that are less than 100 nanometers in size and have unique properties that make them useful for various applications. 3-Methoxyphenylhydrazine HCl is sensitive to visible light, making it suitable for use in microscopy techniques where the sample must be illuminated with visible light.
Formula:C7H10N2O·HClPurity:Min. 95%Molecular weight:174.63 g/mol




