CAS 392331-66-7
:tert-butyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate
Description:
Tert-butyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate is a chemical compound characterized by its piperidine structure, which includes a tert-butyl ester group and an aminomethyl substituent. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential basicity due to the amino group and reactivity due to the carboxylate functionality. It is often utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the hydroxyl group contributes to its solubility in polar solvents and may influence its biological activity. Additionally, the tert-butyl group enhances the compound's stability and steric hindrance, which can affect its interaction with biological targets. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H22N2O3
InChI:InChI=1/C11H22N2O3/c1-10(2,3)16-9(14)13-6-4-11(15,8-12)5-7-13/h15H,4-8,12H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)(CN)O
Synonyms:- 1-Boc-4-(aminomethyl)-4-hydroxypiperidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Aminomethyl-1-Boc-4-hydroxypiperidine, 97%
CAS:4-Aminomethyl-1-Boc-4-hydroxypiperidine can be used in agrochemical, pharmaceutical and dyestuff. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar prFormula:C11H22N2O3Purity:97%Molecular weight:230.3tert-Butyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate
CAS:Formula:C11H22N2O3Purity:97%Color and Shape:SolidMolecular weight:230.3040Ref: IN-DA0075XG
100gTo inquire500gTo inquire250mg30.00€1g57.00€5g108.00€10g165.00€25g248.00€50g622.00€tert-Butyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate
CAS:tert-Butyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylatePurity:98%Color and Shape:Off-White SolidMolecular weight:230.30g/moltert-Butyl 4-(aminomethyl)-4-hydroxytetrahydro-1(2h)-pyridinecarboxylate
CAS:Formula:C11H22N2O3Purity:95%Color and Shape:SolidMolecular weight:230.308



