CAS 392331-78-1

tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate & oxalic acid

Description:

Tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate, associated with the CAS number 392331-78-1, is a chemical compound characterized by its unique spirocyclic structure, which includes a diaza (two nitrogen atoms) framework. This compound features a tert-butyl ester functional group, contributing to its solubility and reactivity. The presence of the carboxylate moiety indicates potential for various chemical interactions, including esterification and nucleophilic substitution. The oxalic acid component suggests the potential for acid-base reactions, as oxalic acid is a dicarboxylic acid known for its ability to form coordination complexes and chelates. The compound's structure may impart specific steric and electronic properties, influencing its behavior in chemical reactions and interactions with biological systems. Overall, the combination of these features makes tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate a compound of interest in synthetic organic chemistry and potentially in medicinal chemistry, depending on its biological activity and applications.

Formula: C₁₄H₂₄N₂O₆

InChI: InChI=1/C12H22N2O2.C2H2O4/c1-11(2,3)16-10(15)14-8-5-12(6-9-14)4-7-13-12;3-1(4)2(5)6/h13H,4-9H2,1-3H3;(H,3,4)(H,5,6)

SMILES: CC(C)(C)OC(=O)N1CCC2(CCN2)CC1.C(=O)(C(=O)O)O

2-Oxo-1,7-diazaspiro[3.5]nonane-7-carboxylic acid tert-butyl ester

CAS: 392331-78-1

Formula: C₁₂H₂₀N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 240.2988

Ref: IN-DA00CAAZ

N-t-BOC-2-Oxo-1,7-Diazaspiro[3.5]nonane

CAS: 392331-78-1

N-t-BOC-2-Oxo-1,7-Diazaspiro[3.5]nonane

Purity: ≥95%

Molecular weight: 240.30g/mol

Ref: 54-OR316062

tert-Butyl 2-oxo-1,7-diazaspiro[3.5]nonane-7-carboxylate

CAS: 392331-78-1

Formula: C₁₂H₂₀N₂O₃

Purity: 98%

Molecular weight: 240.303

Ref: 10-F334798