CAS 39235-92-2
:N~1~-benzyl-4-chlorobenzene-1,2-diamine
Description:
N~1~-benzyl-4-chlorobenzene-1,2-diamine, with the CAS number 39235-92-2, is an organic compound characterized by its structure, which includes a benzyl group and a chlorobenzene moiety attached to a diamine framework. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the chlorine atom introduces electronegative characteristics, potentially affecting the compound's reactivity and stability. N~1~-benzyl-4-chlorobenzene-1,2-diamine may be utilized in various chemical syntheses, including the development of dyes, pharmaceuticals, or as an intermediate in organic reactions. Its physical properties, such as melting point and boiling point, would depend on the specific molecular interactions and the arrangement of its functional groups. Safety data should be consulted for handling, as amines can be hazardous, and appropriate precautions should be taken during its use in laboratory or industrial settings.
Formula:C13H13ClN2
InChI:InChI=1/C13H13ClN2/c14-11-6-7-13(12(15)8-11)16-9-10-4-2-1-3-5-10/h1-8,16H,9,15H2
SMILES:c1ccc(cc1)CNc1ccc(cc1N)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-N-Benzyl-4-chlorobenzene-1,2-diamine
CAS:<p>1-N-Benzyl-4-chlorobenzene-1,2-diamine is a chemical compound that is used as an anticancer drug. It is a potent inhibitor of protein kinase C and has been shown to induce cell cycle arrest in the G1 phase of the cell cycle. 1-N-Benzyl-4-chlorobenzene-1,2-diamine also induces apoptosis in cancer cells. The cytometric analysis of apoptotic processes was used to determine the pharmacokinetic properties of 1-N-Benzyl-4-chlorobenzene-1,2-diamine. This drug may be mediated by annexin A5 or other proteins. Radionuclide imaging studies were conducted in order to assess the pharmacokinetics of 1NBDBCD in humans.</p>Formula:C13H13ClN2Purity:Min. 95%Molecular weight:232.71 g/mol

