CAS 39244-24-1

Carbamic acid, (4-oxocyclohexyl)-, ethyl ester

Description:

Carbamic acid, (4-oxocyclohexyl)-, ethyl ester, with CAS number 39244-24-1, is an organic compound characterized by its carbamate functional group. This substance features a cyclohexane ring with a ketone group at the 4-position, contributing to its unique reactivity and properties. As an ethyl ester, it possesses an ethyl group attached to the carbamic acid moiety, which influences its solubility and volatility. Typically, carbamates exhibit moderate stability and can undergo hydrolysis in the presence of water, leading to the release of the corresponding alcohol and carbamic acid. The compound may be used in various applications, including as an intermediate in organic synthesis or in the development of agrochemicals. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety data should be consulted to understand its toxicity and handling requirements, as carbamates can exhibit varying degrees of biological activity.

Formula: C₉H₁₅NO₃

InChI: InChI=1S/C9H15NO3/c1-2-13-9(12)10-7-3-5-8(11)6-4-7/h7H,2-6H2,1H3,(H,10,12)

InChI key: InChIKey=QTWZIQLAPSOQNL-UHFFFAOYSA-N

SMILES: N(C(OCC)=O)C1CCC(=O)CC1

Synonyms:

• Carbamic acid, (4-oxocyclohexyl)-, ethyl ester

Ethyl N-(4-oxocyclohexyl)carbamate

CAS: 39244-24-1

Versatile small molecule scaffold

Formula: C₉H₁₅NO₃

Purity: Min. 95%

Molecular weight: 185.22 g/mol

Ref: 3D-PBA24424