CAS 39250-90-3
:3,5-dimethyl-4-methoxybenzaldehyde
Description:
3,5-Dimethyl-4-methoxybenzaldehyde, with the CAS number 39250-90-3, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features two methyl groups located at the 3 and 5 positions and a methoxy group at the 4 position of the benzene ring. It is typically a colorless to pale yellow liquid with a pleasant, sweet, and floral odor, making it useful in the fragrance industry. The presence of the aldehyde group contributes to its reactivity, allowing it to participate in various chemical reactions, such as condensation and oxidation. Its solubility in organic solvents, such as ethanol and ether, is notable, while its solubility in water is limited due to the hydrophobic nature of the aromatic ring. 3,5-Dimethyl-4-methoxybenzaldehyde is often utilized in organic synthesis and as an intermediate in the production of other chemical compounds, including pharmaceuticals and agrochemicals. Safety data should be consulted for handling and exposure guidelines.
Formula:C10H12O2
InChI:InChI=1/C10H12O2/c1-7-4-9(6-11)5-8(2)10(7)12-3/h4-6H,1-3H3
SMILES:Cc1cc(cc(C)c1OC)C=O
Synonyms:- 4-Methoxy-3,5-Dimethylbenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzaldehyde,4-methoxy-3,5-dimethyl-
CAS:Formula:C10H12O2Purity:98%Color and Shape:LiquidMolecular weight:164.20113,5-Dimethyl-4-methoxybenzaldehyde
CAS:3,5-Dimethyl-4-methoxybenzaldehyde
Purity:97%Molecular weight:164.20g/mol3,5-Dimethyl-4-methoxybenzaldehyde
CAS:3,5-Dimethyl-4-methoxybenzaldehyde is a high quality, versatile chemical that can be used as an intermediate to synthesize other fine chemicals. The compound can be reacted with various reagents to produce complex compounds. 3,5-Dimethyl-4-methoxybenzaldehyde can also be used as a building block to synthesize other useful compounds. This chemical has been shown to be a useful scaffold for the production of new compounds and has been used as a reaction component in research and development.Formula:C10H12O2Purity:Min. 95%Color and Shape:PowderMolecular weight:164.2 g/mol3,5-Dimethyl-4-methoxybenzaldehyde
CAS:Formula:C10H12O2Purity:96%Color and Shape:Liquid, ClearMolecular weight:164.204



