CAS 39252-02-3

Furfuryl hexanoate

Description:

Furfuryl hexanoate, with the CAS number 39252-02-3, is an ester derived from furfuryl alcohol and hexanoic acid. It is characterized by its pleasant fruity aroma, which makes it useful in flavoring and fragrance applications. The compound is typically a colorless to pale yellow liquid, exhibiting low volatility and moderate solubility in organic solvents. Furfuryl hexanoate has a relatively low molecular weight and is known for its stability under normal conditions, although it may be sensitive to strong acids or bases. Its chemical structure includes a furfuryl group, which contributes to its reactivity and potential applications in various chemical syntheses. Additionally, it is considered to have low toxicity, making it suitable for use in food-related applications, although regulatory guidelines should always be followed. Overall, furfuryl hexanoate is valued for its sensory properties and versatility in both industrial and consumer products.

Formula: C₁₁H₁₆O₃

InChI: InChI=1S/C11H16O3/c1-2-3-4-7-11(12)14-9-10-6-5-8-13-10/h5-6,8H,2-4,7,9H2,1H3

InChI key: InChIKey=IBIDUABZZSJJNF-UHFFFAOYSA-N

SMILES: C(OC(CCCCC)=O)C1=CC=CO1

Synonyms:

• Furfuryl hexanoate
• Hexanoic acid, furfuryl ester
• Hexanoic acid, 2-furanylmethyl ester