CAS 39254-90-5

4-Thiazolidinecarboxylic acid, methyl ester, (S)-

Description:

4-Thiazolidinecarboxylic acid, methyl ester, (S)-, with the CAS number 39254-90-5, is a chiral compound characterized by its thiazolidine ring structure, which contains a sulfur atom and a carboxylic acid functional group. This compound typically exhibits properties associated with thiazolidines, such as being a solid at room temperature and having a relatively low solubility in non-polar solvents. The methyl ester group enhances its solubility in polar organic solvents, making it useful in various chemical applications. As a chiral molecule, it can exist in two enantiomeric forms, with the (S)- configuration being biologically relevant in many contexts, particularly in pharmaceuticals. The compound may participate in various chemical reactions, including esterification and nucleophilic substitutions, and can serve as a building block in the synthesis of more complex molecules. Its potential applications span medicinal chemistry, where it may be explored for its biological activity, and in synthetic organic chemistry for the development of new compounds.

Formula: C₅H₉NO₂S

InChI: InChI=1S/C5H9NO2S/c1-8-5(7)4-2-9-3-6-4/h4,6H,2-3H2,1H3/t4-/m1/s1

InChI key: InChIKey=NHBNAVLHRAPNKY-SCSAIBSYSA-N

SMILES: C(OC)(=O)[C@H]1CSCN1

Synonyms:

• (S)-Methyl thiazolidine-4-carboxylate
• 4-Thiazolidinecarboxylic acid, methyl ester, (S)-
• Methyl 1,3-Thiazolidine-4-Carboxylate
• methyl (4S)-1,3-thiazolidine-4-carboxylate

Thiazolidine-4-carboxylic acid methyl ester

CAS: 39254-90-5

Formula: C₅H₉NO₂S

Color and Shape: Liquid

Molecular weight: 147.19

Ref: 10-F027324