CAS 39262-22-1
:(+)-camphor-10-sulfonyl chloride
Description:
(+)-Camphor-10-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group attached to a camphor backbone. It is typically a white to off-white crystalline solid, exhibiting a strong odor reminiscent of camphor. This compound is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. It is often used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other derivatives. The compound is soluble in organic solvents such as dichloromethane and ether but is generally insoluble in water. Safety precautions are necessary when handling this substance, as it can be corrosive and may cause irritation to the skin, eyes, and respiratory system. Proper storage in a cool, dry place away from moisture and incompatible substances is recommended to maintain its stability and reactivity.
Formula:C10H15ClO3S
InChI:InChI=1/C10H15ClO3S/c1-9(2)7-3-4-10(9,8(12)5-7)6-15(11,13)14/h7H,3-6H2,1-2H3/t7?,10-/m0/s1
SMILES:CC1(C)C2CC[C@]1(CS(=O)(=O)Cl)C(=O)C2
Synonyms:- (-)-10-Camphorsulfonyl chloride
- (1R)-(?-10-Camphorsulfonyl chloride
- (1R)-(-)-Camphor-10-sulphonyl chloride
- 6,(IR)-(-)-10-Camphorsulfonyl Chloride
- R(-)Camphor sulfonyl chloride
- [(1R,4S)-7,7-dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulfonyl chloride
- [(1R)-7,7-dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulfonyl chloride
- L(-)-10-Camphorsulfonyl Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
((1R,4S)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonyl chloride
CAS:Formula:C10H15ClO3SPurity:98%Color and Shape:SolidMolecular weight:250.7423(-)-10-Camphorsulfonyl Chloride
CAS:Formula:C10H15ClO3SPurity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:250.74((1R,4S)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonyl chloride
CAS:Formula:C10H15ClO3SPurity:95.0%Color and Shape:SolidMolecular weight:250.74(1R)-(-)-10-Camphorsulfonyl Chloride
CAS:Controlled Product<p>Applications A chiral derivative of Camphor.<br>References Peng, R., et al.: Biochem. Pharmacol., 35, 1391 (1986), Tanaka, E., et al.: Biochem. Pharmacol., 41, 472 (1991),<br></p>Formula:C10H15ClO3SColor and Shape:NeatMolecular weight:250.74L(-)-10-Camphorsulfonyl Chloride
CAS:<p>L(-)-10-Camphorsulfonyl Chloride</p>Formula:C10H15ClO3SPurity:97%Color and Shape: white crystalline solidMolecular weight:250.74g/mol




