CAS 39263-81-5

2-phenyl-1,2,4-triazaspiro[4.5]dec-3-ene-3-thiol

Description:

2-Phenyl-1,2,4-triazaspiro[4.5]dec-3-ene-3-thiol is a heterocyclic compound characterized by its unique spiro structure, which incorporates both nitrogen and sulfur atoms. The presence of the triazole ring contributes to its stability and reactivity, while the phenyl group enhances its aromatic characteristics. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry. The thiol functional group (-SH) is known for its nucleophilicity and ability to form disulfide bonds, which can influence the compound's reactivity and interactions with other molecules. Additionally, the spiro configuration can impart distinctive steric and electronic properties, affecting its behavior in chemical reactions. Overall, 2-phenyl-1,2,4-triazaspiro[4.5]dec-3-ene-3-thiol is a complex molecule with potential applications in various fields, including pharmaceuticals and materials science, due to its unique structural features and functional groups.

Formula: C₁₃H₁₇N₃S

InChI: InChI=1/C13H17N3S/c17-12-14-13(9-5-2-6-10-13)15-16(12)11-7-3-1-4-8-11/h1,3-4,7-8,15H,2,5-6,9-10H2,(H,14,17)

SMILES: c1ccc(cc1)N1C(=NC2(CCCCC2)N1)S

Synonyms:

• 2-Phenyl-1,2,4-Triazaspiro[4.5]Decane-3-Thione

2-Phenyl-1,2,4-triazaspiro[4.5]dec-3-ene-3-thiol

CAS: 39263-81-5

2-Phenyl-1,2,4-triazaspiro[4.5]dec-3-ene-3-thiol

Purity: ≥95%

Molecular weight: 247.36g/mol

Ref: 54-OR18403