CAS 392662-65-6

3,6-dibromothieno[3,2-b]thiophene

Description:

3,6-Dibromothieno[3,2-b]thiophene is a heterocyclic organic compound characterized by its fused thiophene rings and bromine substituents at the 3 and 6 positions. This compound features a unique thieno[3,2-b]thiophene structure, which contributes to its electronic properties, making it of interest in organic electronics and materials science. The presence of bromine atoms enhances its reactivity and solubility, which can be advantageous in various applications, including organic semiconductors and photovoltaic devices. Additionally, the compound exhibits notable thermal stability and can participate in various chemical reactions, such as cross-coupling reactions, due to the presence of the bromine substituents. Its molecular structure allows for potential applications in the development of organic light-emitting diodes (OLEDs) and field-effect transistors (FETs). Overall, 3,6-dibromothieno[3,2-b]thiophene is a significant compound in the field of organic chemistry, particularly in the development of advanced materials for electronic applications.

Formula: C₆H₂Br₂S₂

InChI: InChI=1/C6H2Br2S2/c7-3-1-9-6-4(8)2-10-5(3)6/h1-2H

SMILES: c1c(c2c(c(cs2)Br)s1)Br

Synonyms:

• Thieno[3,2-B]Thiophene, 3,6-Dibromo-
• 3,6-Dibromo-Thieno[3,2-B]Thiophene
• 3,6-Dibromothieno[3,2-b]thiophene

3,6-Dibromothieno[3,2-b]thiophene

CAS: 392662-65-6

Formula: C₆H₂Br₂S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 298.0181

Ref: IN-DA003IQB

3,6-Dibromothieno[3,2-b]thiophene

CAS: 392662-65-6

3,6-Dibromothieno[3,2-b]thiophene

Purity: 98%

Molecular weight: 298.02g/mol

Ref: 54-OR480723

3,6-Dibromothieno[3,2-b]thiophene

CAS: 392662-65-6

Formula: C₆H₂Br₂S₂

Purity: >98.0%(GC)

Color and Shape: White to Yellow to Orange powder to crystal

Molecular weight: 298.01

Ref: 3B-D3679

3,6-Dibromothieno[3,2-b]thiophene

CAS: 392662-65-6

3,6-Dibromothieno[3,2-b]thiophene is a semiconducting material that has been shown to have electron mobility of 1.5 cm2/Vs and an enhancement factor of ~5 in pyridine as the acceptor molecule. The compound is processed into thin films using chemical vapor deposition and shows potential for use in transistors. 3,6-Dibromothieno[3,2-b]thiophene is also a natural gas sensor that can be used to detect methane concentrations in the range of 0.1% - 10% by volume.

Formula: C₆H₂Br₂S₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 298.02 g/mol

Ref: 3D-FD62226

3,6-Dibromothieno[3,2-b]thiophene

CAS: 392662-65-6

Formula: C₆H₂Br₂S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 298.01

Ref: 10-F222185