CAS 39267-74-8

2,5,6-Triamino-4-hydroxypyrimidine sulfate

Description:

2,5,6-Triamino-4-hydroxypyrimidine sulfate is a chemical compound characterized by its pyrimidine structure, which features three amino groups and a hydroxyl group attached to the pyrimidine ring. This compound is typically encountered as a sulfate salt, enhancing its solubility in water. It is known for its potential applications in pharmaceuticals, particularly as a precursor in the synthesis of various bioactive molecules. The presence of multiple amino groups contributes to its reactivity and ability to form hydrogen bonds, which can influence its biological activity and interaction with other molecules. Additionally, the hydroxyl group can participate in various chemical reactions, making it a versatile compound in organic synthesis. The sulfate moiety not only aids in solubility but may also play a role in the compound's stability and bioavailability. Overall, 2,5,6-Triamino-4-hydroxypyrimidine sulfate is of interest in medicinal chemistry and research due to its structural features and potential therapeutic applications.

Formula: C₄H₇N₅O·xH₂O₄S

InChI: InChI=1S/C4H7N5O.H2O4S/c5-1-2(6)8-4(7)9-3(1)10;1-5(2,3)4/h5H2,(H5,6,7,8,9,10);(H2,1,2,3,4)

InChI key: InChIKey=RSKNEEODWFLVFF-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)O.NC1=C(N)NC(N)=NC1=O

Synonyms:

• 2,4,5-Triamino-6-hydroxypyrimidine sulfate
• 2,5,6-Triamino-4-hydroxypyrimidine sulfate
• 4(1H)-Pyrimidinone, 2,5,6-triamino-, sulfate
• 4(3H)-Pyrimidinone, 2,5,6-triamino-, sulfate (1:?)
• 4-Hydroxy-2,5,6-triaminopyrimidine sulfate
• 6-Hydroxy-2,4,5-triaminopyrimidine sulfate
• 2,5,6-Triaminopyrimidin-4(1H)-one sulphate

4(1H)-Pyrimidinone, 2,5,6-triamino-, sulfate

CAS: 39267-74-8

Formula: C₄H₉N₅O₅S

Purity: 95%

Color and Shape: Solid

Molecular weight: 239.2098

Ref: IN-DA0075WN

Folic Acid Hydrate EP Impurity B (as Sulfate)

Controlled Product

CAS: 39267-74-8

Formula: C₄H₇N₅O·H₂O₄S

Color and Shape: Neat

Molecular weight: 239.21

Ref: 86-MM0621.02

2,5,6-Triaminopyrimidin-4(1H)-one sulphate

CAS: 39267-74-8

2,5,6-Triaminopyrimidin-4(1H)-one sulphate

Formula: C₄H₇N₅O·H₂SO₄

Purity: 95%

Color and Shape: light yellow/brown solid

Molecular weight: 239.20975g/mol

Ref: 54-OR51801

2,5,6-Triaminopyrimidin-4(1H)-one Sulphate

Controlled Product

CAS: 39267-74-8

Applications 2,5,6-Triaminopyrimidin-4(1H)-one sulphate (cas# 39267-74-8) is a useful research chemical.

Formula: C₄H₇N₅O·H₂O₄S

Color and Shape: Neat

Molecular weight: 239.21

Ref: TR-T896540