CymitQuimica logo

CAS 3927-60-4

:

11-methoxy-11-oxoundecanoic acid

Description:
11-Methoxy-11-oxoundecanoic acid, with the CAS number 3927-60-4, is a fatty acid derivative characterized by the presence of a methoxy group and a ketone functional group at the 11th carbon position of a undecanoic acid chain. This compound typically exhibits properties associated with fatty acids, such as being hydrophobic due to its long carbon chain, while the methoxy and ketone functionalities introduce polar characteristics that can influence its solubility and reactivity. The presence of the ketone group suggests potential for reactivity in various chemical reactions, including condensation and oxidation. Additionally, the methoxy group can affect the compound's biological activity and interactions with other molecules. This substance may find applications in organic synthesis, as well as in the development of surfactants or emulsifiers, owing to its amphiphilic nature. As with many fatty acid derivatives, its physical properties, such as melting point and boiling point, can vary based on the molecular structure and the presence of functional groups.
Formula:C12H22O4
InChI:InChI=1/C12H22O4/c1-16-12(15)10-8-6-4-2-3-5-7-9-11(13)14/h2-10H2,1H3,(H,13,14)
InChI key:JAELIPKEGUQPKD-UHFFFAOYSA-N
SMILES:COC(=O)CCCCCCCCCC(=O)O
Synonyms:
  • Methylhydrogenhendecanedioate
Found 5 products.