CAS 392741-27-4

Propanamide, 2-chloro-N-(2,4-difluorophenyl)-

Description:

Propanamide, 2-chloro-N-(2,4-difluorophenyl)-, is an organic compound characterized by its amide functional group, which consists of a carbonyl (C=O) linked to a nitrogen atom (N). This compound features a propanamide backbone, with a chlorine atom and a difluorophenyl group attached to the nitrogen. The presence of the chlorine and fluorine substituents contributes to its unique chemical properties, potentially influencing its reactivity and polarity. The difluorophenyl moiety may enhance the compound's lipophilicity and biological activity, making it of interest in pharmaceutical applications. Additionally, the compound's structure suggests it may participate in hydrogen bonding due to the amide group, which can affect its solubility in various solvents. As with many halogenated compounds, it may exhibit specific environmental and toxicological considerations. Overall, the characteristics of this compound make it a subject of interest in both synthetic chemistry and medicinal chemistry research.

Formula: C₉H₈ClF₂NO

InChI: InChI=1S/C9H8ClF2NO/c1-5(10)9(14)13-8-3-2-6(11)4-7(8)12/h2-5H,1H3,(H,13,14)

InChI key: InChIKey=MMUOMZVFPKYTKB-UHFFFAOYSA-N

SMILES: N(C(C(C)Cl)=O)C1=C(F)C=C(F)C=C1

Synonyms:

• Propanamide, 2-chloro-N-(2,4-difluorophenyl)-
• 2-Chloro-N-(2,4-difluorophenyl)propanamide

N-(2,4-Difluorophenyl)-2-chloropropanamide

CAS: 392741-27-4

Please enquire for more information about N-(2,4-Difluorophenyl)-2-chloropropanamide including the price, delivery time and more detailed product information at the technical inquiry form on this page

Purity: Min. 95%

Ref: 3D-FD169151