CAS 393-53-3
:3-Fluoropyridine-4-carboxylic acid
Description:
3-Fluoropyridine-4-carboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a fluorine atom at the 3-position and a carboxylic acid group (-COOH) at the 4-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in polar solvents such as water and alcohols, owing to the hydrophilic nature of the carboxylic acid group. The fluorine substituent can influence the compound's reactivity and polarity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, 3-fluoropyridine-4-carboxylic acid can participate in various reactions, such as nucleophilic substitutions and coupling reactions, due to the presence of both the electron-withdrawing fluorine and the acidic carboxylic group. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C6H4FNO2
InChI:InChI=1/C6H4FNO2/c7-5-4(6(9)10)2-1-3-8-5/h1-3H,(H,9,10)
SMILES:c1cc(c(F)nc1)C(=O)O
Synonyms:- T6Nj Bf Cvq [Wln]
- 3-Fluoroisonicotinic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Fluoropyridine-4-carboxylic acid, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H4FNO2Purity:97%Color and Shape:Powder, White to pale creamMolecular weight:141.103-Fluoroisonicotinic acid monohydrate
CAS:Formula:C6H4FNO2Purity:97%Color and Shape:SolidMolecular weight:141.09993-Fluoroisonicotinic Acid
CAS:Formula:C6H4FNO2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:141.103-Fluoroisonicotinic acid
CAS:3-Fluoroisonicotinic acidFormula:C6H4FNO2Purity:98%Color and Shape: white to off-white solidMolecular weight:141.10g/mol3-Fluoro-4-pyridinecarboxylic acid
CAS:Formula:C6H4FNO2Purity:98%Color and Shape:SolidMolecular weight:141.101






