CAS 393101-41-2
:Milataxel
Description:
Milataxel, with the CAS number 393101-41-2, is a synthetic chemotherapeutic agent that belongs to the class of taxanes, which are derived from the yew tree. It is primarily characterized by its ability to inhibit cell division by stabilizing microtubules, thereby preventing the normal breakdown of the mitotic spindle during cell division. This mechanism makes Milataxel effective against various types of cancer, particularly those that are resistant to other treatments. The compound exhibits a complex structure, featuring a taxane core with specific modifications that enhance its pharmacological properties. Milataxel is known for its improved solubility and bioavailability compared to traditional taxanes, which can lead to better therapeutic outcomes. Additionally, it has been studied for its potential to overcome multidrug resistance in cancer cells. As with many chemotherapeutic agents, its use may be associated with side effects, including myelosuppression, neuropathy, and gastrointestinal disturbances, necessitating careful monitoring during treatment.
Formula:C44H55NO16
InChI:InChI=1S/C44H55NO16/c1-10-29(47)58-27-19-28-43(21-56-28,60-23(3)46)34-36(59-37(51)24-15-12-11-13-16-24)44(54)20-26(22(2)30(41(44,7)8)32(48)35(50)42(27,34)9)57-38(52)33(49)31(25-17-14-18-55-25)45-39(53)61-40(4,5)6/h11-18,26-28,31-34,36,48-49,54H,10,19-21H2,1-9H3,(H,45,53)/t26-,27-,28+,31-,32+,33+,34?,36-,42+,43-,44+/m0/s1
InChI key:InChIKey=XIVMHSNIQAICTR-DMUFGCTNSA-N
SMILES:O(C(C)=O)[C@]12C3([C@H](OC(=O)C4=CC=CC=C4)[C@@]5(O)C(C)(C)C([C@@H](O)C(=O)[C@]3(C)[C@@H](OC(CC)=O)C[C@]1(OC2)[H])=C(C)[C@@H](OC([C@@H]([C@@H](NC(OC(C)(C)C)=O)C6=CC=CO6)O)=O)C5)[H]
Synonyms:- 2-Furanpropanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-α-hydroxy-, (2aR,4S,4aS,6R,9S,11S,12S,12bS)-12b-(acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12a,12b-dodecahydro-6,11-dihydroxy-4a,8,13,13-tetramethyl-5-oxo-4-(1-oxopropoxy)-7,11-methano-1H-cyclodeca[3,4]benz[1,2-b]oxet-9-yl ester, (αR,βR)-
- Mac 321
- Milataxel
- TL 00139
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
