CAS 3934-86-9
:methyl 3,4-dihydroxy-5-methoxybenzoate
Description:
Methyl 3,4-dihydroxy-5-methoxybenzoate, also known by its CAS number 3934-86-9, is an organic compound belonging to the class of benzoates. This substance features a benzoic acid core substituted with hydroxyl (-OH) and methoxy (-OCH₃) groups, which contribute to its chemical properties and potential biological activities. It is typically characterized by its white to off-white crystalline appearance and is soluble in organic solvents, with limited solubility in water. The presence of multiple hydroxyl groups suggests that it may exhibit antioxidant properties, making it of interest in various fields, including pharmaceuticals and cosmetics. Additionally, the methoxy group can enhance its lipophilicity, potentially influencing its absorption and distribution in biological systems. Methyl 3,4-dihydroxy-5-methoxybenzoate may also be studied for its role in natural product synthesis and its potential therapeutic applications, particularly in relation to its effects on cellular processes. As with many organic compounds, proper handling and safety measures should be observed due to its chemical reactivity and potential health effects.
Formula:C9H10O5
InChI:InChI=1/C9H10O5/c1-13-7-4-5(9(12)14-2)3-6(10)8(7)11/h3-4,10-11H,1-2H3
SMILES:COc1cc(cc(c1O)O)C(=O)OC
Synonyms:- Benzoic acid, 3,4-dihydroxy-5-methoxy-, methyl ester
- 3,4-Dihydroxy-5-methoxy methyl benzoate
- 3,4-Dihydroxy-5-Methoxybenzoic Acid Methyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4-Dihydroxy-5-methoxybenzoic acid methyl ester
CAS:Formula:C9H10O5Purity:95%Color and Shape:SolidMolecular weight:198.17273,4-Dihydroxy-5-methoxybenzoic acid methyl ester
CAS:3,4-Dihydroxy-5-methoxybenzoic acid methyl esterPurity:95%Molecular weight:198.17g/molMethyl 3-O-methylgallate
CAS:Methyl 3-O-methylgallate (M3OMG) is a rare natural product that showed promising antioxidant activities.Formula:C9H10O5Purity:96.86% - 99.93%Color and Shape:SolidMolecular weight:198.173,4-Dihydroxy-5-methoxybenzoic acid methyl ester
CAS:Formula:C9H10O5Purity:95%Color and Shape:SolidMolecular weight:198.174



