CAS 3934-87-0
:3,4-Dihydroxy-5-methoxybenzaldehyde
Description:
3,4-Dihydroxy-5-methoxybenzaldehyde, also known as vanillin, is an organic compound characterized by its aromatic structure featuring a benzene ring with multiple functional groups. It contains two hydroxyl (-OH) groups and one methoxy (-OCH₃) group, contributing to its reactivity and solubility in various solvents. The presence of the aldehyde (-CHO) group makes it a key intermediate in organic synthesis and a valuable compound in the flavor and fragrance industry. This compound typically exhibits a pale yellow to brownish color and has a sweet, vanilla-like aroma, which is why it is often used as a flavoring agent. Its solubility in alcohol and ether, along with moderate solubility in water, allows for diverse applications in food, cosmetics, and pharmaceuticals. Additionally, 3,4-Dihydroxy-5-methoxybenzaldehyde may exhibit antioxidant properties and has been studied for potential biological activities, including antimicrobial and anti-inflammatory effects. Proper handling and storage are essential due to its reactive nature and potential health effects upon exposure.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c1-12-7-3-5(4-9)2-6(10)8(7)11/h2-4,10-11H,1H3
InChI key:InChIKey=RRKMWVISRMWBAL-UHFFFAOYSA-N
SMILES:O(C)C1=C(O)C(O)=CC(C=O)=C1
Synonyms:- 3-Methoxy-4,5-dihydroxybenzaldehyde
- 4,5-Dihydroxy-3-methoxybenzaldehyde
- 5-Hydroxyvanilin
- 5-Hydroxyvanillin
- Benzaldehyde, 3,4-dihydroxy-5-methoxy-
- NSC 16679
- Protocatechualdehyde, 5-methoxy-
- 3,4-Dihydroxy-5-methoxybenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3,4-Dihydroxy-5-methoxybenzaldehyde
CAS:Formula:C8H8O4Purity:96%Color and Shape:SolidMolecular weight:168.14675-Hydroxyvanillin
CAS:5-Hydroxyvanillin (3,4-Dihydroxy-5-methoxybenzaldehyde) can be isolated from indica rice and has an inhibitory effect on Staphylococcus aureus, which can beFormula:C8H8O4Purity:99.08%Color and Shape:SolidMolecular weight:168.153,4-Dihydroxy-5-methoxybenzaldehyde
CAS:Formula:C8H8O4Purity:>98.0%(GC)(T)Color and Shape:White to Yellow powder to crystalMolecular weight:168.153,4-Dihydroxy-5-methoxybenzaldehyde
CAS:3,4-Dihydroxy-5-methoxybenzaldehydeFormula:C8H8O4Purity:95%Color and Shape: light grey/ brown solidMolecular weight:168.15g/mol3,4-Dihydroxy-5-methoxybenzaldehyde
CAS:3,4-Dihydroxy-5-methoxybenzaldehyde is a synthetic compound that has shown to have inhibitory effects on the replication of DNA and RNA. It also inhibits the growth of bacteria in culture by binding to the nucleic acid. The chemical structure of 3,4-Dihydroxy-5-methoxybenzaldehyde is similar to that of bisbenzylisoquinoline alkaloids, which are found in plants such as opium poppy. This similarity may explain its ability to inhibit bacterial growth. 3,4-Dihydroxy-5-methoxybenzaldehyde may be used as a drug candidate for treating bacterial infections.
Formula:C8H8O4Purity:Min. 95%Color and Shape:PowderMolecular weight:168.15 g/mol3,4-Dihydroxy-5-methoxybenzaldehyde
CAS:Formula:C8H8O4Purity:95%Color and Shape:SolidMolecular weight:168.148





