CAS 393509-23-4

(5-bromo-7-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetic acid

Description:

(5-bromo-7-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetic acid is a chemical compound characterized by its complex bicyclic structure, which includes a tetrahydrocyclopenta[b]indole moiety. The presence of bromine and fluorine substituents contributes to its unique reactivity and potential biological activity. This compound features an acetic acid functional group, which may enhance its solubility in polar solvents and influence its interaction with biological targets. The bromine and fluorine atoms can affect the compound's electronic properties, potentially impacting its pharmacokinetics and pharmacodynamics. As a result, this substance may exhibit interesting properties in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific applications and biological activities would depend on further studies, including in vitro and in vivo evaluations. Overall, the structural characteristics of this compound suggest it may be of interest in research fields such as drug discovery and development, particularly for conditions where indole derivatives have shown therapeutic potential.

Formula: C₁₃H₁₁BrFNO₂

InChI: InChI=1/C13H11BrFNO2/c14-10-5-7(15)4-9-8-2-1-6(3-11(17)18)12(8)16-13(9)10/h4-6,16H,1-3H2,(H,17,18)

SMILES: C1Cc2c3cc(cc(c3[nH]c2C1CC(=O)O)Br)F

2-(5-Bromo-7-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetic acid

CAS: 393509-23-4

Formula: C₁₃H₁₁BrFNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 312.1343

Ref: IN-DA0075B4

2-(5-Bromo-7-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetic acid

CAS: 393509-23-4

2-(5-Bromo-7-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetic acid

Purity: 95%

Molecular weight: 312.14g/mol

Ref: 54-PC1002381

2-(5-Bromo-7-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetic acid

CAS: 393509-23-4

Purity: 95.0%

Molecular weight: 312.13800048828125

Ref: 10-F334908