CymitQuimica logo

CAS 393568-74-6

:

D-Histidine, N-[(1,1-dimethylethoxy)carbonyl]-1-(triphenylmethyl)-

Description:
D-Histidine, N-[(1,1-dimethylethoxy)carbonyl]-1-(triphenylmethyl)-, identified by its CAS number 393568-74-6, is a synthetic amino acid derivative that features a histidine backbone modified with a triphenylmethyl group and a tert-butoxycarbonyl (Boc) protecting group. This compound is characterized by its ability to participate in various chemical reactions typical of amino acids, such as peptide bond formation. The presence of the triphenylmethyl group enhances its stability and solubility in organic solvents, making it useful in peptide synthesis and other organic chemistry applications. The Boc group serves as a protective moiety, allowing for selective reactions at the amino group while preventing unwanted side reactions. D-Histidine itself is an important amino acid that plays a role in protein synthesis and is involved in various biological processes. The specific modifications in this compound can influence its reactivity, solubility, and overall utility in biochemical research and pharmaceutical development.
Formula:C30H31N3O4
InChI:InChI=1S/C30H31N3O4/c1-29(2,3)37-28(36)32-26(27(34)35)19-25-20-33(21-31-25)30(22-13-7-4-8-14-22,23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-18,20-21,26H,19H2,1-3H3,(H,32,36)(H,34,35)/t26-/m1/s1
InChI key:OYXZPXVCRAAKCM-AREMUKBSSA-N
SMILES:CC(C)(C)OC(=O)N[C@H](CC1=CN(C=N1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O
Synonyms:
  • Boc-D-His(Trt)-OH
Found 4 products.