CAS 3938-16-7
:3,6-Dichloro-1,2-benzenediol
Description:
3,6-Dichloro-1,2-benzenediol, also known as 3,6-dichlororesorcinol, is an organic compound characterized by the presence of two hydroxyl (-OH) groups and two chlorine atoms attached to a benzene ring. This compound typically appears as a white to light yellow crystalline solid. It is soluble in water and organic solvents, which enhances its utility in various applications. The presence of chlorine substituents contributes to its reactivity, making it useful in chemical synthesis and as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. Additionally, 3,6-dichloro-1,2-benzenediol exhibits antimicrobial properties, which can be advantageous in certain formulations. However, like many chlorinated compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Its chemical structure allows for various reactions, including substitution and oxidation, which are important in organic chemistry. Overall, 3,6-dichloro-1,2-benzenediol is a versatile compound with significant industrial relevance.
Formula:C6H4Cl2O2
InChI:InChI=1S/C6H4Cl2O2/c7-3-1-2-4(8)6(10)5(3)9/h1-2,9-10H
InChI key:InChIKey=OLCABUKQCUOXNU-UHFFFAOYSA-N
SMILES:OC1=C(O)C(Cl)=CC=C1Cl
Synonyms:- 1,2-Benzenediol, 3,6-dichloro-
- 1,4-Dichloro-2,3-dihydroxybenzene
- 3,6-Dichloro-1,2-benzenediol
- 3,6-Dichloro-1,2-dihydroxybenzene
- 3,6-Dichloro-benzene-1,2-diol
- 3,6-Dichlorocatechol
- 3,6-Dichloropyrocatechol
- Pyrocatechol, 3,6-dichloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3,6-Dichlorocatechol
CAS:3,6-Dichlorocatechol serves as a substrate for the broad-spectrum chlorocatechol 1,2-dioxygenase found in pseudomonas chlororaphis RW71.Formula:C6H4Cl2O2Molecular weight:1793,6-DICHLOROBENZENE-1,2-DIOL
CAS:Formula:C6H4Cl2O2Purity:95%Color and Shape:No data available.Molecular weight:1793,6-Dichlorobenzene-1,2-diol
CAS:3,6-Dichlorobenzene-1,2-diol is a conjugate acid of benzene. It has two dimensions in the plane of the molecule and three dimensions in space. The molecule is composed of six carbon atoms, six hydrogen atoms, and one chlorine atom. 3,6-Dichlorobenzene-1,2-diol has a centroid at the center of the molecule that is surrounded by a ring of four hydrogen atoms. The hydrogen-bonded molecules stack on top of each other to form a hexagonal shape. 3,6-Dichlorobenzene-1,2-diol forms hydrogen bonds with other molecules through its lone pairs of electrons on both oxygen atoms as well as through its pi electron system.Formula:C6H4Cl2O2Purity:Min. 95%Molecular weight:179 g/mol





