CAS 39389-20-3: Benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene
Description:Benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene, identified by CAS number 39389-20-3, is a synthetic polymer that exhibits characteristics typical of sulfonated aromatic compounds. This polymer is formed through the polymerization of ethenylbenzenesulfonic acid and diethenylbenzene, resulting in a structure that incorporates sulfonic acid functional groups, which contribute to its hydrophilicity and ionic properties. The presence of these sulfonic groups enhances the polymer's solubility in polar solvents and its ability to interact with various ions, making it useful in applications such as ion exchange resins and as a dispersant in various formulations. The polymer is generally stable under a range of environmental conditions, although its properties can be influenced by factors such as pH and temperature. Additionally, due to its aromatic structure, it may exhibit good thermal stability and mechanical strength, making it suitable for various industrial applications, including coatings, adhesives, and as a component in composite materials.
Formula:(C10H10·C8H8O3S)x
InChI:InChI=1/C10H10.C8H8O3S/c1-3-9-7-5-6-8-10(9)4-2;1-2-7-5-3-4-6-8(7)12(9,10)11/h3-8H,1-2H2;2-6H,1H2,(H,9,10,11)
- Synonyms:
- 2-Ethenylbenzenesulfonic Acid - 1,2-Diethenylbenzene (1:1)
- Amberjet 1200(H)
- Amberlyst 174
- Amberlyst 36
- Amberlyst(rg 15
- Amberlyst(rg 15 (wet)
- Benzene, diethenyl-, polymer with ethenylbenzenesulfonic acid
- Benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene
- DVB-Styrene sulfonic acid copolymer
- Divinylbenzene-styrenesulfonic acid copolymer
- See more synonyms
- Vinylbenzenesulfonic acid-divinylbenzene copolymer
- amberjet 1200(H) ion-exchange resin
