CAS 3939-12-6
:5-Cyano-2-fluoropyridine
Description:
5-Cyano-2-fluoropyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a cyano group (-C≡N) at the 5-position and a fluorine atom at the 2-position of the pyridine ring contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its utility in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of both the cyano and fluorine substituents. The cyano group can participate in nucleophilic reactions, while the fluorine atom can influence the compound's electronic properties and reactivity. Additionally, 5-cyano-2-fluoropyridine may exhibit moderate to high solubility in polar organic solvents, making it a versatile intermediate in various chemical reactions. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C6H3FN2
InChI:InChI=1/C6H3FN2/c7-6-2-1-5(3-8)4-9-6/h1-2,4H
SMILES:c1cc(F)ncc1C#N
Synonyms:- 6-Fluoronicotinonitrile
- 6-Fluoropyridine-3-Carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Cyano-2-fluoropyridine, 95%
CAS:<p>It is an important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. </p>Formula:C6H3FN2Purity:95%Molecular weight:122.105-Cyano-2-fluoropyridine
CAS:<p>5-Cyano-2-fluoropyridine</p>Formula:C6H3FN2Purity:97%Color and Shape: colourless to off white crystalline solidMolecular weight:122.10g/mol
