CAS 3939-23-9
:3-bromo-10H-phenothiazine
Description:
3-Bromo-10H-phenothiazine is an organic compound characterized by its phenothiazine backbone, which consists of a sulfur atom and a nitrogen atom within a tricyclic structure. The presence of a bromine atom at the 3-position of the phenothiazine ring significantly influences its chemical properties and reactivity. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals, particularly as an antipsychotic agent and in the development of dyes and pigments. Its molecular structure contributes to its ability to interact with biological systems, making it of interest in medicinal chemistry. Additionally, 3-bromo-10H-phenothiazine may exhibit various physical properties such as solubility in organic solvents and specific melting and boiling points, which are influenced by the bromine substitution. The compound's reactivity can also be affected by the presence of functional groups, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C12H8BrNS
InChI:InChI=1/C12H8BrNS/c13-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)14-10/h1-7,14H
SMILES:c1ccc2c(c1)Nc1ccc(cc1S2)Br
Synonyms:- 10H-phenothiazine, 3-bromo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-bromo-10H-phenothiazine
CAS:Formula:C12H8BrNSPurity:98%Color and Shape:SolidMolecular weight:278.16763-Bromo-10H-phenothiazine
CAS:<p>3-Bromo-10H-phenothiazine is a fluorescence sensor that is sensitive to the presence of aromatic heterocycles. The molecule is an ion-pair, which means that it has two parts: a charged part and a neutral part. The charge can be either positive or negative. When the molecule interacts with polycyclic aromatic hydrocarbons (PAHs), the charge changes from positive to negative, which causes an increase in fluorescence. 3-Bromo-10H-phenothiazine has been used as a sensor for PAHs in air samples and ground water samples. It was also used as a photocurrent generator in solar cells.</p>Formula:C12H8BrNSPurity:Min. 95%Molecular weight:278.17 g/mol



