CAS 394-39-8

4-Chloro-2-fluorobenzoyl chloride

Description:

4-Chloro-2-fluorobenzoyl chloride, with the CAS number 394-39-8, is an aromatic acyl chloride characterized by the presence of both a chloro and a fluoro substituent on the benzene ring. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the acyl chloride functional group, which makes it a useful intermediate in organic synthesis. It is soluble in organic solvents such as dichloromethane and ether but is generally insoluble in water. The presence of the chloro and fluoro groups can influence its chemical behavior, including its reactivity with nucleophiles, making it valuable in the synthesis of pharmaceuticals and agrochemicals. As with many acyl chlorides, it can release hydrogen chloride upon hydrolysis, necessitating careful handling and storage under inert conditions to prevent moisture exposure. Safety precautions are essential due to its corrosive nature and potential to cause irritation upon contact with skin or mucous membranes.

Formula: C₇H₃Cl₂FO

InChI: InChI=1S/C7H3Cl2FO/c8-4-1-2-5(7(9)11)6(10)3-4/h1-3H

InChI key: InChIKey=PWHFJLCMUCFYRQ-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C1=C(F)C=C(Cl)C=C1

Synonyms:

• 2-Fluoro-4-chlorobenzoyl chloride
• Benzoyl chloride, 4-chloro-2-fluoro-
• 4-Chloro-2-fluorobenzoyl chloride

4-Chloro-2-fluorobenzoyl chloride

CAS: 394-39-8

4-Chloro-2-fluorobenzoyl chloride

Formula: C₇H₃Cl₂FO

Purity: 97%

Color and Shape: clear. faint yellow liquid

Molecular weight: 193.00g/mol

Ref: 54-PC7798

4-Chloro-2-fluorobenzoyl chloride

CAS: 394-39-8

Formula: C₇H₃Cl₂FO

Purity: 97.0%

Color and Shape: Clear

Molecular weight: 193

Ref: 10-F009723