CAS 394-42-3
:2-Fluoro-4-methoxybenzoic acid
Description:
2-Fluoro-4-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a methoxy group on a benzene ring. The molecular structure features a benzoic acid core, where the carboxylic acid (-COOH) group is attached to the benzene ring, along with a methoxy group (-OCH3) at the para position and a fluorine atom at the ortho position relative to the carboxylic acid. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water. It exhibits properties typical of benzoic acids, such as acidity and the ability to participate in hydrogen bonding. The presence of the fluorine atom can influence its reactivity and polarity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Safety data indicates that it should be handled with care, as with many organic compounds, due to potential irritant properties.
Formula:C8H6ClFO2
InChI:InChI=1/C8H6ClFO2/c1-12-5-2-3-6(8(9)11)7(10)4-5/h2-4H,1H3
SMILES:COc1ccc(c(c1)F)C(=O)Cl
Synonyms:- 2-Fluoro-P-Anisic Acid
- Buttpark 32\01-80
- Rarechem Al Be 0456
- 2-Fluoro-4-Methoxybenzoate
- 2-Fluoro-4-Methoxy Benzoic Acid
- 2-Fluoro-4-Methoxybenzoyl Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Fluoro-4-methoxybenzoic acid
CAS:Formula:C8H7FO3Purity:98%Color and Shape:SolidMolecular weight:170.13782-Fluoro-4-methoxybenzoic acid
CAS:2-Fluoro-4-methoxybenzoic acidFormula:C8H7FO3Purity:≥95%Color and Shape: off-white powderMolecular weight:170.14g/mol2-Fluoro-4-methoxybenzoic Acid
CAS:Formula:C8H7FO3Purity:>98.0%(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:170.142-Fluoro-4-methoxybenzoic acid
CAS:Formula:C8H7FO3Purity:98%Color and Shape:SolidMolecular weight:170.1392-Fluoro-4-methoxybenzoic acid
CAS:2-Fluoro-4-methoxybenzoic acid (2FMBA) is a potent antimicrobial agent that inhibits the growth of bacteria, fungi and other microorganisms. 2FMBA has significant antibacterial activity against Gram-positive and Gram-negative bacteria and also has significant antifungal activity against Candida albicans. 2FMBA is active in the presence of light and is a strong acid. It can be synthesized by refluxing benzoic acid with hydrazine, or by reacting an aromatic carboxylic acid with oxychloride. 2FMBA is used to treat bacterial infections such as E. coli, Staphylococcus, Salmonella, Shigella and Mycoplasma; fungal infections such as Candida albicans; and protozoal infections such as Giardia lamblia.Formula:C8H7FO3Purity:Min. 95%Color and Shape:SolidMolecular weight:170.14 g/mol




