CAS 394-67-2
:4-Fluoroisoquinoline
Description:
4-Fluoroisoquinoline is a heterocyclic organic compound characterized by a fused bicyclic structure that includes a benzene ring and a pyridine ring, with a fluorine atom substituted at the 4-position of the isoquinoline framework. Its molecular formula is C9H6FN, indicating the presence of nine carbon atoms, six hydrogen atoms, one fluorine atom, and one nitrogen atom. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. 4-Fluoroisoquinoline is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. It exhibits moderate to low solubility in water but is more soluble in organic solvents. The presence of the fluorine atom can enhance the compound's lipophilicity and metabolic stability, making it a valuable scaffold in drug design. As with many heterocycles, it may also exhibit interesting electronic properties, which can be exploited in various chemical reactions and applications.
Formula:C9H6FN
InChI:InChI=1/C9H6FN/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-6H
SMILES:c1ccc2c(c1)cncc2F
Synonyms:- Isoquinoline, 4-Fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ref: IN-DA003LFI
1g69.00€5g164.00€10g229.00€50gTo inquire100gTo inquire250gTo inquire100mg25.00€250mg38.00€4-Fluoroisoquinoline
CAS:Formula:C9H6FNPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to lumpMolecular weight:147.154-Fluoroisoquinoline
CAS:4-Fluoroisoquinoline is a synthetic compound that can be produced by the reduction of an acetonitrile-chlorinated isoquinoline compound. It is also possible to produce 4-fluoroisoquinoline by the reaction of chlorinating agents with an aldehyde, followed by the addition of phosphorus oxychloride and fluorine. The reductive sulfonation of 4-fluoroisoquinoline can be achieved by reacting it with sulfur trioxide, which is in turn generated from phosphorous oxychloride and sulfur dioxide. This process produces the desired product in good yields.
Formula:C9H6FNPurity:Min. 95%Color and Shape:Brown PowderMolecular weight:147.15 g/mol




