CAS 3940-27-0
:Serine, ethyl ester, hydrochloride (1:1)
Description:
Serine, ethyl ester, hydrochloride (1:1) is a chemical compound that serves as a derivative of the amino acid serine, where the amino group is modified by an ethyl ester and the compound is presented as a hydrochloride salt. This substance typically appears as a white crystalline powder and is soluble in water, which is a characteristic of many amino acid derivatives. The presence of the ethyl ester group enhances its lipophilicity compared to the parent amino acid, potentially influencing its biological activity and absorption properties. As a hydrochloride salt, it is stabilized by the presence of hydrochloric acid, which can affect its stability and solubility in various solvents. Serine itself plays a crucial role in protein synthesis and is involved in various metabolic pathways, including those related to neurotransmitter synthesis. The ethyl ester form may be utilized in biochemical research and pharmaceutical applications, particularly in studies involving amino acid metabolism or as a building block in peptide synthesis. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C5H11NO3·ClH
InChI:InChI=1S/C5H11NO3.ClH/c1-2-9-5(8)4(6)3-7;/h4,7H,2-3,6H2,1H3;1H
InChI key:InChIKey=JZJQCLZQSHLSFB-UHFFFAOYSA-N
SMILES:C(C(CO)N)(OCC)=O.Cl
Synonyms:- <span class="text-smallcaps">DL</span>-Serine, ethyl ester, hydrochloride
- H-DL-Ser-OEt・HCl
- NSC 29417
- Serine, ethyl ester, hydrochloride
- Serine, ethyl ester, hydrochloride (1:1)
- Serine, ethyl ester, hydrochloride, <span class="text-smallcaps">DL</span>-
- ethyl D-serinate
- DL-Serine, ethyl ester, hydrochloride
- Serine, ethyl ester, hydrochloride, DL-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
H-DL-Serine ethyl ester HCl
CAS:Formula:C5H12ClNO3Purity:97%Color and Shape:SolidMolecular weight:169.6067Ethyl 2-amino-3-hydroxypropanoate hydrochloride
CAS:Ethyl 2-amino-3-hydroxypropanoate hydrochloridePurity:98%Color and Shape:PowderMolecular weight:169.61g/molEthyl 2-Amino-3-hydroxypropanoate hydrochloride
CAS:Formula:C5H12ClNO3Purity:97%Color and Shape:SolidMolecular weight:169.61Ethyl 2-amino-3-hydroxypropanoate hydrochloride
CAS:Ethyl 2-amino-3-hydroxypropanoate hydrochloride is a compound that is found in lichen. It can be synthesized by the ammonolysis of ethyl 3-aminopropanoate, which can be obtained from l-threonine and 3-hydroxypropionic acid. The synthesis of this compound proceeds through an aldol condensation followed by oxidation with sodium azide to form aziridine. Ethyl 2-amino-3-hydroxypropanoate hydrochloride has been used as a chemical intermediate for the synthesis of other compounds, such as oxazolidinones, dihydropyridines, and indole derivatives.Formula:C5H12ClNO3Purity:Min. 95%Molecular weight:169.61 g/mol




