CAS 39422-19-0
:6-{[4-amino-6-({3-[(2-amino-2-carboxyethyl)sulfanyl]-1-carboxypropyl}carbamoyl)-3-hydroxytetrahydro-2H-pyran-2-yl]oxy}-2-(4-amino-2-oxopyrimidin-1(2H)-yl)-7-(carbamoylamino)-3-hydroxyhexahydro-2H-furo[3,2-b]pyran-5-carboxylic acid (non-preferred name)
Description:
The chemical substance with the name "6-{[4-amino-6-({3-[(2-amino-2-carboxyethyl)sulfanyl]-1-carboxypropyl}carbamoyl)-3-hydroxytetrahydro-2H-pyran-2-yl]oxy}-2-(4-amino-2-oxopyrimidin-1(2H)-yl)-7-(carbamoylamino)-3-hydroxyhexahydro-2H-furo[3,2-b]pyran-5-carboxylic acid" and CAS number "39422-19-0" is a complex organic molecule characterized by multiple functional groups, including amino, carboxylic acid, and hydroxyl groups. This structure suggests potential biological activity, possibly as a pharmaceutical compound. The presence of a pyrimidine ring and a furo[3,2-b]pyran moiety indicates that it may interact with biological targets, such as enzymes or receptors. Its solubility and stability in various solvents can be influenced by the functional groups present, which may also affect its pharmacokinetic properties. The intricate arrangement of substituents implies that it could exhibit specific interactions in biological systems, making it a candidate for further investigation in medicinal chemistry. Overall, this compound's complexity and diverse functional groups highlight its potential significance in drug development and therapeutic applications.
Formula:C26H38N8O15S
InChI:InChI=1/C26H38N8O15S/c27-7-5-10(19(37)31-9(22(40)41)2-4-50-6-8(28)21(38)39)46-24(13(7)35)49-16-12(33-25(30)44)15-17(47-18(16)23(42)43)14(36)20(48-15)34-3-1-11(29)32-26(34)45/h1,3,7-10,12-18,20,24,35-36H,2,4-6,27-28H2,(H,31,37)(H,38,39)(H,40,41)(H,42,43)(H2,29,32,45)(H3,30,33,44)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ezomycin A1
CAS:<p>Ezomycin A1 is an antifungal antibiotic effective primarily against plant pathogens such as Sclerotinia and Botrytis. It is used to prevent and control diseases like Sclerotinia rot, gray mold, and candidiasis in crops.</p>Formula:C26H38N8O15SColor and Shape:SolidMolecular weight:734.69
