CAS 394223-19-9

1H-Pyrrolo[3,2-b]pyridine-2-carboxylic acid, methyl ester

Description:

1H-Pyrrolo[3,2-b]pyridine-2-carboxylic acid, methyl ester, is a heterocyclic organic compound characterized by its pyrrole and pyridine rings fused together, which contributes to its unique chemical properties. This compound features a carboxylic acid functional group that is esterified with a methyl group, enhancing its solubility in organic solvents. It typically exhibits moderate polarity due to the presence of both aromatic and polar functional groups. The compound is often utilized in medicinal chemistry and drug development due to its potential biological activity, particularly in the context of targeting specific enzymes or receptors. Its structural complexity allows for various synthetic modifications, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, it may exhibit interesting spectroscopic properties, such as UV-Vis and NMR, which can be used for characterization and analysis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c1-13-9(12)8-5-7-6(11-8)3-2-4-10-7/h2-5,11H,1H3

InChI key: InChIKey=BXBHZLHTTHMUTG-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC=2C(N1)=CC=CN2

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-2-carboxylic acid, methyl ester
• Methyl 1H-pyrrolo[3,2-b]pyridine-2-carboxylate
• Methyl 1H-pyrrolo[3,2-b]pyridine-2-carboxylate

Methyl 1H-pyrrolo[3,2-b]pyridine-2-carboxylate

CAS: 394223-19-9

Formula: C₉H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.1720

Ref: IN-DA003RKG

Methyl 4-azaindole-2-carboxylate

CAS: 394223-19-9

Methyl 4-azaindole-2-carboxylate

Purity: ≥95%

Molecular weight: 176.17g/mol

Ref: 54-OR41118

METHYL 1H-PYRROLO[3,2-B]PYRIDINE-2-CARBOXYLATE

CAS: 394223-19-9

Formula: C₉H₈N₂O₂

Purity: >97%

Color and Shape: Solid

Molecular weight: 176.175

Ref: 10-F305233