CAS 394246-74-3: Notoginsenoside M

Description:Notoginsenoside M is a saponin compound derived from Panax notoginseng, a plant known for its medicinal properties. It is characterized by its complex glycosidic structure, which contributes to its biological activity. Notoginsenoside M exhibits various pharmacological effects, including anti-inflammatory, antioxidant, and neuroprotective properties. It is believed to modulate several signaling pathways, which may enhance its therapeutic potential in conditions such as cardiovascular diseases and neurodegenerative disorders. The compound is typically studied for its role in promoting blood circulation and alleviating pain, making it of interest in traditional medicine and modern pharmacology. Additionally, its solubility and stability in different solvents can influence its bioavailability and efficacy. As research continues, Notoginsenoside M may reveal further insights into its mechanisms of action and potential applications in health and disease management.

Formula:C₄₈H₈₂O₁₉

InChI:InChI=1S/C48H82O19/c1-21(2)10-9-13-48(8,67-43-39(61)35(57)32(54)26(19-50)65-43)22-11-15-46(6)30(22)23(51)16-28-45(5)14-12-29(52)44(3,4)40(45)24(17-47(28,46)7)63-42-38(60)36(58)33(55)27(66-42)20-62-41-37(59)34(56)31(53)25(18-49)64-41/h10,22-43,49-61H,9,11-20H2,1-8H3/t22-,23+,24-,25+,26+,27+,28+,29-,30-,31+,32+,33+,34-,35-,36-,37+,38+,39+,40-,41-,42+,43-,45+,46+,47+,48-/m0/s1

InChI key:InChIKey=SXNNDEIXKBANEP-JODPPCSYSA-N

SMILES:OCC1OC(OCC2OC(OC3CC4(C)C(CC(O)C5C(CCC54C)C(OC6OC(CO)C(O)C(O)C6O)(C)CCC=C(C)C)C7(C)CCC(O)C(C)(C)C37)C(O)C(O)C2O)C(O)C(O)C1O

Synonyms:
(3β,6α,12β)-20-(β-D-Glucopyranosyloxy)-3,12-dihydroxydammar-24-en-6-yl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside
Notoginsenoside M
β-D-Glucopyranoside, (3β,6α,12β)-20-(β-D-glucopyranosyloxy)-3,12-dihydroxydammar-24-en-6-yl 6-O-β-D-glucopyranosyl-