CymitQuimica logo

CAS 3943-73-5

:

ethyl 2,3-dihydroxybenzoate

Description:
Ethyl 2,3-dihydroxybenzoate, with the CAS number 3943-73-5, is an organic compound that belongs to the class of benzoate esters. It is characterized by the presence of an ethyl group attached to a benzoic acid derivative that features two hydroxyl (-OH) groups at the 2 and 3 positions of the aromatic ring. This structure imparts both hydrophilic and lipophilic properties, making it soluble in organic solvents while also exhibiting some degree of water solubility. Ethyl 2,3-dihydroxybenzoate is often used in the synthesis of various chemical compounds and may serve as an intermediate in organic reactions. Its hydroxyl groups can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, this compound may exhibit antioxidant properties due to the presence of the hydroxyl groups, which can scavenge free radicals. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C9H10O4
InChI:InChI=1/C9H10O4/c1-2-13-9(12)6-4-3-5-7(10)8(6)11/h3-5,10-11H,2H2,1H3
InChI key:RHMQSXRCGOZYND-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cccc(c1O)O
Synonyms:
  • 2,3-Dihydroxy-benzoic acid ethyl ester
Found 4 products.