CAS 3943-80-4
:Ethyl syringate
Description:
Ethyl syringate, with the CAS number 3943-80-4, is an organic compound that belongs to the class of phenolic compounds. It is characterized by its ester functional group, derived from syringic acid and ethanol. Ethyl syringate typically appears as a colorless to pale yellow liquid with a pleasant, sweet aroma, making it useful in flavoring and fragrance applications. The compound is soluble in organic solvents and exhibits moderate solubility in water. Ethyl syringate is known for its antioxidant properties, which can contribute to its potential health benefits. Additionally, it has been studied for its role in various biological activities, including anti-inflammatory and antimicrobial effects. Its stability under various conditions makes it a valuable ingredient in cosmetic formulations and food products. As with many organic compounds, safety data should be consulted to ensure proper handling and usage, as it may pose risks if ingested or improperly handled.
Formula:C11H14O5
InChI:InChI=1/C11H14O5/c1-4-16-11(13)7-5-8(14-2)10(12)9(6-7)15-3/h5-6,12H,4H2,1-3H3
InChI key:InChIKey=WKUVKFZZCHINKG-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC(OC)=C(O)C(OC)=C1
Synonyms:- Benzoic acid, 4-hydroxy-3,5-dimethoxy-, ethyl ester
- Ethyl 3,5-dimethoxy-4-hydroxybenzoate
- Ethyl 4-Hydroxy-3,5-Dimethoxy-Benzoate
- Ethyl syringate
- Syringic acid ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
ethyl 4-hydroxy-3,5-dimethoxy-benzoate
CAS:Formula:C11H14O5Purity:97%Color and Shape:SolidMolecular weight:226.2259Ethyl 4-hydroxy-3,5-dimethoxybenzoate
CAS:Ethyl 4-hydroxy-3,5-dimethoxybenzoatePurity:97%Molecular weight:226.23g/molethyl 4-hydroxy-3,5-dimethoxy-benzoate
CAS:Ethyl 4-hydroxy-3,5-dimethoxybenzoate is a benzoic acid ester that is used as an intermediate in the synthesis of detergent compositions. It can be used to inhibit the growth of microorganisms and has been found to have no adverse effects on human serum. Ethyl 4-hydroxy-3,5-dimethoxybenzoate has been shown to have antimicrobial activity against group P2 bacteria and has also been used in the treatment of protocatechuic acid and ethyl decanoate.
Formula:C11H14O5Purity:Min. 95%Molecular weight:226.23 g/mol


