CAS 39489-77-5

2,4-Dichloro-5-nitrophenol

Description:

2,4-Dichloro-5-nitrophenol is an organic compound characterized by its aromatic structure, featuring a phenolic group substituted with two chlorine atoms and one nitro group. This compound typically appears as a yellow crystalline solid and is known for its moderate solubility in water and higher solubility in organic solvents. It has a melting point that varies depending on purity and specific conditions. The presence of chlorine and nitro groups contributes to its chemical reactivity, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, 2,4-Dichloro-5-nitrophenol exhibits antimicrobial properties, which can be leveraged in certain applications. However, it is important to handle this compound with care due to its potential toxicity and environmental impact. Proper safety measures should be observed when working with this substance, including the use of personal protective equipment and adherence to regulatory guidelines.

Formula: C₆H₃Cl₂NO₃

InChI: InChI=1/C6H3Cl2NO3/c7-3-1-4(8)6(10)2-5(3)9(11)12/h1-2,10H

SMILES: c1c(c(cc(c1Cl)O)N(=O)=O)Cl

2,4-Dichloro-5-nitrophenol

CAS: 39489-77-5

Formula: C₆H₃Cl₂NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 207.9989

Ref: IN-DA003FQJ

2,4-Dichloro-5-nitrophenol

CAS: 39489-77-5

2,4-Dichloro-5-nitrophenol

Formula: C₆H₃Cl₂NO₃

Purity: 98%

Color and Shape: light brown to brown solid

Molecular weight: 208.00g/mol

Ref: 54-OR8241

2,4-Dichloro-5-nitrophenol

CAS: 39489-77-5

Formula: C₆H₃Cl₂NO₃

Purity: 98%

Molecular weight: 207.99

Ref: 10-F210655

2,4-Dichloro-5-nitrophenol

Controlled Product

CAS: 39489-77-5

Formula: C₆H₃Cl₂NO₃

Color and Shape: Neat

Molecular weight: 208.0

Ref: TR-D432070