CAS 39491-51-5
:6-(6-amino-9H-purin-9-yl)-N,2,2-trimethyltetrahydrofuro[3,4-d][1,3]dioxole-4-carboxamide (non-preferred name)
Description:
The chemical substance known as 6-(6-amino-9H-purin-9-yl)-N,2,2-trimethyltetrahydrofuro[3,4-d][1,3]dioxole-4-carboxamide, with the CAS number 39491-51-5, is a complex organic compound characterized by its unique structural features. It contains a purine base, which is indicative of its potential biological activity, particularly in relation to nucleic acids. The presence of a tetrahydrofurodioxole moiety suggests that it may exhibit interesting chemical reactivity and stability. This compound is likely to be soluble in polar solvents due to the presence of amide and amino functional groups, which can engage in hydrogen bonding. Its molecular structure may confer specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the trimethyl substitution indicates potential lipophilicity, which could influence its pharmacokinetic properties. Overall, this compound's unique combination of features positions it as a candidate for further investigation in biochemical applications.
Formula:C14H18N6O4
InChI:InChI=1/C14H18N6O4/c1-14(2)23-7-8(12(21)16-3)22-13(9(7)24-14)20-5-19-6-10(15)17-4-18-11(6)20/h4-5,7-9,13H,1-3H3,(H,16,21)(H2,15,17,18)
SMILES:CC1(C)OC2C(C(=NC)O)OC(C2O1)n1cnc2c(N)ncnc12
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2',3'-O-Isopropylidene-adenosine-5-N-methylcarbamide
CAS:2',3'-O-Isopropylidene-adenosine-5-N-methylcarbamide is an activator that has anticancer and antiviral properties. It is a synthetic nucleoside, which is a modified form of the natural nucleosides adenosine and cytidine. 2',3'-O-Isopropylidene-adenosine-5-N-methylcarbamide inhibits the replication of DNA by binding to the deoxyribonucleoside triphosphate (dNTP) in DNA synthesis. The drug also inhibits viral RNA transcription by blocking the action of diphosphate reductase, an enzyme required for the conversion of ribonucleosides to ribonucleotides. 2',3'-O-Isopropylidene-adenosine-5-N-methylcarbamide has shown antiproliferative effects on human cancer cells in vitro and may be effective against leukemia and lymphFormula:C14H18N6O4Purity:Min. 95%Molecular weight:334.33 g/mol
