CAS 39493-62-4
:Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate
Description:
Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate, identified by its CAS number 39493-62-4, is an organic compound characterized by its cyclohexene structure, which features a carboxylate ester functional group. This compound typically exhibits a molecular structure that includes a methyl group and a hydroxyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the keto group (2-oxo) indicates that it may participate in various chemical reactions, such as condensation or nucleophilic addition. Methyl esters like this one are often used in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to their versatility. Additionally, the compound's specific stereochemistry and functional groups can influence its physical properties, such as solubility and boiling point, as well as its biological activity. Overall, Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate is a valuable compound in the field of organic chemistry, with potential applications in various chemical processes.
Formula:C9H12O4
InChI:InChI=1/C9H12O4/c1-5-3-6(10)4-7(11)8(5)9(12)13-2/h4-5,8,10H,3H2,1-2H3
SMILES:CC1CC(=CC(=O)C1C(=O)OC)O
Synonyms:- 5,6-Dihydroorsellinic acid methyl ester~4-Hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate methyl ester~Methyl 5-methylcyclohexene-1,3-dione-4-carboxylate
- Methyl 4-Hydroxy-6-Methyl-2-Oxocyclohex-3-Ene-1-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate, 99%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H12O4Purity:99%Color and Shape:White to cream, PowderMolecular weight:184.19Methyl 2-methyl-4,6-dioxocyclohexanecarboxylate
CAS:Formula:C9H12O4Purity:99%Color and Shape:SolidMolecular weight:184.1892

