CAS 39494-07-0
:3-chloro-N-(2,5-dimethylphenyl)propanamide
Description:
3-Chloro-N-(2,5-dimethylphenyl)propanamide is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a chlorine atom at the third position of the propanamide chain contributes to its reactivity and potential applications in various chemical reactions. The 2,5-dimethylphenyl group attached to the nitrogen atom enhances the compound's lipophilicity, which can influence its solubility and biological activity. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, and the chlorine substituent may also affect its electronic properties. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, 3-chloro-N-(2,5-dimethylphenyl)propanamide represents a unique structure that could be explored for various applications in research and industry.
Formula:C11H14ClNO
InChI:InChI=1/C11H14ClNO/c1-8-3-4-9(2)10(7-8)13-11(14)5-6-12/h3-4,7H,5-6H2,1-2H3,(H,13,14)
SMILES:Cc1ccc(C)c(c1)N=C(CCCl)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
