CAS 39495-15-3

N-(4-Hydroxy-2-methylphenyl)acetamide

Description:

N-(4-Hydroxy-2-methylphenyl)acetamide, also known as paracetamol or acetaminophen, is an organic compound characterized by its aromatic structure and functional groups. It features a hydroxyl group (-OH) and an acetamide group (-NHCOCH3) attached to a benzene ring, which contributes to its solubility in water and organic solvents. This compound is typically a white crystalline solid with a melting point that varies depending on purity. It exhibits analgesic and antipyretic properties, making it widely used as a pain reliever and fever reducer in both over-the-counter and prescription medications. The compound is generally considered safe when used as directed, although excessive doses can lead to hepatotoxicity. Its mechanism of action involves the inhibition of cyclooxygenase enzymes, which play a role in the synthesis of prostaglandins, thereby reducing pain and inflammation. Additionally, N-(4-Hydroxy-2-methylphenyl)acetamide is stable under normal conditions but should be stored away from moisture and light to maintain its efficacy.

Formula: C₉H₁₁NO₂

InChI: InChI=1S/C9H11NO2/c1-6-5-8(12)3-4-9(6)10-7(2)11/h3-5,12H,1-2H3,(H,10,11)

InChI key: InChIKey=JPLCVGBNQZNQBO-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1=C(C)C=C(O)C=C1

Synonyms:

• N-(4-Hydroxy-2-methylphenyl)acetamide
• 4-Acetylamino-m-cresol
• Acetamide, N-(4-hydroxy-2-methylphenyl)-
• 4′-Hydroxy-o-acetyltoluidide
• 4-Acetamido-3-methylphenol

N-(4-Hydroxy-2-methylphenyl)acetamide

Controlled Product

CAS: 39495-15-3

Formula: C₉H₁₁NO₂

Color and Shape: Neat

Molecular weight: 165.189

Ref: TR-N297596