CAS 3951-10-8

4-Methoxyphenylacetic Anhydride

Description:

4-Methoxyphenylacetic Anhydride, with the CAS number 3951-10-8, is an organic compound characterized by its anhydride functional group derived from 4-methoxyphenylacetic acid. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its reactivity, particularly in acylation reactions, where it can act as a reagent to introduce the 4-methoxyphenylacetyl group into various substrates. The presence of the methoxy group enhances its electrophilic character, making it useful in organic synthesis. Additionally, 4-Methoxyphenylacetic Anhydride is soluble in organic solvents such as dichloromethane and ethyl acetate, but it is generally insoluble in water. Safety considerations include handling it with care, as it may cause irritation to the skin and eyes, and proper protective equipment should be used. Its applications span across pharmaceuticals and fine chemical synthesis, where it serves as an intermediate in the production of various compounds.

Formula: C₁₈H₁₈O₅

InChI: InChI=1/C18H18O5/c1-21-15-7-3-13(4-8-15)11-17(19)23-18(20)12-14-5-9-16(22-2)10-6-14/h3-10H,11-12H2,1-2H3

SMILES: COc1ccc(cc1)CC(=O)OC(=O)Cc1ccc(cc1)OC

4-Methoxyphenylacetic Anhydride

CAS: 3951-10-8

Formula: C₁₈H₁₈O₅

Purity: >98.0%(T)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 314.34

Ref: 3B-M0968

4-Methoxyphenylacetic anhydride

CAS: 3951-10-8

Formula: C₁₈H₁₈O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 314.3325

Ref: IN-DA003LOR

2-(4-Methoxyphenyl)Acetic Anhydride

CAS: 3951-10-8

2-(4-Methoxyphenyl)Acetic Anhydride

Purity: 98%

Molecular weight: 314.33g/mol

Ref: 54-OR1029638

2-(4-Methoxyphenyl)acetic anhydride

CAS: 3951-10-8

Purity: 98%(LC-MS);RG

Molecular weight: 314.3370056

Ref: 10-F773589