CAS 395101-67-4

3-bromo-1H-indazole-5-carbonitrile

Description:

3-Bromo-1H-indazole-5-carbonitrile is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 3-position and a cyano group (-C≡N) at the 5-position contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential use in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the indazole moiety, which is known for its biological activity. Additionally, the cyano group can serve as a versatile functional group for further chemical modifications. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-bromo-1H-indazole-5-carbonitrile is of interest in synthetic organic chemistry and drug discovery.

Formula: C₈H₄BrN₃

InChI: InChI=1/C8H4BrN3/c9-8-6-3-5(4-10)1-2-7(6)11-12-8/h1-3H,(H,11,12)

SMILES: c1cc2c(cc1C#N)c(Br)n[nH]2

Synonyms:

• 1H-Indazole-5-carbonitrile, 3-bromo-

3-Bromo-1H-indazole-5-carbonitrile

CAS: 395101-67-4

Formula: C₈H₄BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 222.0415

Ref: IN-DA003IZH

3-Bromo-1H-indazole-5-carbonitrile

CAS: 395101-67-4

3-Bromo-1H-indazole-5-carbonitrile

Purity: 97%

Molecular weight: 222.04g/mol

Ref: 54-OR76505

3-Bromo-1H-indazole-5-carbonitrile

CAS: 395101-67-4

Formula: C₈H₄BrN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 222.045

Ref: 10-F214777

3-BROMO-1H-INDAZOLE-5-CARBONITRILE

CAS: 395101-67-4

Purity: 97%

Molecular weight: 222.0449982

Ref: 10-F800351