CymitQuimica logo

CAS 395101-69-6

:

3-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole-5-carbonitrile

Description:
3-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole-5-carbonitrile is a chemical compound characterized by its complex structure, which includes an indazole core, a bromine substituent, and a carbonitrile functional group. The presence of the tetrahydro-2H-pyran moiety contributes to its cyclic nature and may influence its solubility and reactivity. This compound is typically used in medicinal chemistry and drug development due to its potential biological activity. The bromine atom can enhance the compound's reactivity, making it a useful intermediate in various synthetic pathways. Additionally, the carbonitrile group is known for its ability to participate in nucleophilic reactions, further expanding its utility in organic synthesis. The compound's specific properties, such as melting point, boiling point, and solubility, can vary based on the conditions and purity, but it is generally considered to be a stable entity under standard laboratory conditions. Overall, 3-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole-5-carbonitrile represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C13H12BrN3O
InChI:InChI=1S/C13H12BrN3O/c14-13-10-7-9(8-15)4-5-11(10)17(16-13)12-3-1-2-6-18-12/h4-5,7,12H,1-3,6H2
InChI key:InChIKey=IZJBRHVACFOJFY-UHFFFAOYSA-N
SMILES:BrC=1C=2C(N(N1)C3CCCCO3)=CC=C(C#N)C2
Synonyms:
  • 3-Bromo-1-(oxan-2-yl)indazole-5-carbonitrile
  • 3-Bromo-1-(perhydro-2H-pyran-2-yl)-1H-indazole-5-carbonitrile
  • 3-Bromo-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole-5-carbonitrile
  • 1H-Indazole-5-carbonitrile, 3-bromo-1-(tetrahydro-2H-pyran-2-yl)-
Found 1 products.